C23H13ClFN3O7S — CID 124641814
(5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124641814) has the molecular formula C23H13ClFN3O7S and a molecular weight of 529.89 g/mol. Its IUPAC name is (5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124641814 |
| Molecular Formula | C23H13ClFN3O7S |
| Molecular Weight | 529.89 g/mol |
| Exact Mass | 529.01 |
| IUPAC Name | (5E)-3-[(2-chloro-4-fluorophenyl)methyl]-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)C(=O)N1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H13ClFN3O7S/c24-18-10-15(25)5-4-14(18)12-26-22(29)21(36-23(26)30)9-13-2-1-3-17(8-13)35-20-7-6-16(27(31)32)11-19(20)28(33)34/h1-11H,12H2/b21-9+ |
| InChIKey | DUXGDRMYCHYGCD-ZVBGSRNCSA-N |
| XLogP | 6.32 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.89 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|