C11H6N2O7S — CID 66438461
4-(2,4-dinitrophenoxy)thiophene-2-carboxylic acid (PubChem CID 66438461) has the molecular formula C11H6N2O7S and a molecular weight of 310.24 g/mol. Its IUPAC name is 4-(2,4-dinitrophenoxy)thiophene-2-carboxylic acid.
| Compound Name | 4-(2,4-dinitrophenoxy)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66438461 |
| Molecular Formula | C11H6N2O7S |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 4-(2,4-dinitrophenoxy)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H6N2O7S/c14-11(15)10-4-7(5-21-10)20-9-2-1-6(12(16)17)3-8(9)13(18)19/h1-5H,(H,14,15) |
| InChIKey | OWXWDNCDZWYRNP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|