C12H10N4O7S — CID 134112914
2-(2,5-dinitrophenoxy)ethyl 4-methylthiadiazole-5-carboxylate (PubChem CID 134112914) has the molecular formula C12H10N4O7S and a molecular weight of 354.30 g/mol. Its IUPAC name is 2-(2,5-dinitrophenoxy)ethyl 4-methylthiadiazole-5-carboxylate.
| Compound Name | 2-(2,5-dinitrophenoxy)ethyl 4-methylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 134112914 |
| Molecular Formula | C12H10N4O7S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-(2,5-dinitrophenoxy)ethyl 4-methylthiadiazole-5-carboxylate |
| SMILES | Cc1nnsc1C(=O)OCCOc1cc([N+](=O)[O-])ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N4O7S/c1-7-11(24-14-13-7)12(17)23-5-4-22-10-6-8(15(18)19)2-3-9(10)16(20)21/h2-3,6H,4-5H2,1H3 |
| InChIKey | CJHKBVJPVKUMAM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 147.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|