C14H14N2O5S — CID 60606283
2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-methoxy-5-nitrobenzoate (PubChem CID 60606283) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-methoxy-5-nitrobenzoate.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-methoxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 60606283 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 2-methoxy-5-nitrobenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)OCCc1scnc1C |
| InChI | InChI=1S/C14H14N2O5S/c1-9-13(22-8-15-9)5-6-21-14(17)11-7-10(16(18)19)3-4-12(11)20-2/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | HUPBSZIOGYUUSY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|