C21H18ClN2O5S+ — CID 2307109
2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-chloro-5-nitrobenzoate (PubChem CID 2307109) has the molecular formula C21H18ClN2O5S+ and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-chloro-5-nitrobenzoate.
| Compound Name | 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 2307109 |
| Molecular Formula | C21H18ClN2O5S+ |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-chloro-5-nitrobenzoate |
| SMILES | Cc1c(CCOC(=O)c2cc([N+](=O)[O-])ccc2Cl)sc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H18ClN2O5S/c1-14-20(30-13-23(14)12-19(25)15-5-3-2-4-6-15)9-10-29-21(26)17-11-16(24(27)28)7-8-18(17)22/h2-8,11,13H,9-10,12H2,1H3/q+1 |
| InChIKey | LZUUIQKROIRUQC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|