C27H34NO3S+ — CID 98121118
2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-[(5R,7R)-3-methyl-1-adamantyl]acetate (PubChem CID 98121118) has the molecular formula C27H34NO3S+ and a molecular weight of 452.64 g/mol. Its IUPAC name is 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-[(5R,7R)-3-methyl-1-adamantyl]acetate.
| Compound Name | 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-[(5R,7R)-3-methyl-1-adamantyl]acetate |
|---|---|
| PubChem CID | 98121118 |
| Molecular Formula | C27H34NO3S+ |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl 2-[(5R,7R)-3-methyl-1-adamantyl]acetate |
| SMILES | Cc1c(CCOC(=O)CC23C[C@@H]4C[C@H](CC(C)(C4)C2)C3)sc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H34NO3S/c1-19-24(32-18-28(19)16-23(29)22-6-4-3-5-7-22)8-9-31-25(30)15-27-13-20-10-21(14-27)12-26(2,11-20)17-27/h3-7,18,20-21H,8-17H2,1-2H3/q+1/t20-,21-,26?,27?/m1/s1 |
| InChIKey | FHMGAVYHQNYIIQ-CUFNRJLSSA-N |
| XLogP | 5.31 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|