C15H10Cl3NO5 — CID 7891622
2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-nitrobenzoate (PubChem CID 7891622) has the molecular formula C15H10Cl3NO5 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-nitrobenzoate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 7891622 |
| Molecular Formula | C15H10Cl3NO5 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-nitrobenzoate |
| SMILES | O=C(OCCOc1ccc(Cl)cc1Cl)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H10Cl3NO5/c16-9-1-4-14(13(18)7-9)23-5-6-24-15(20)11-8-10(19(21)22)2-3-12(11)17/h1-4,7-8H,5-6H2 |
| InChIKey | UMAJUGDLULFILY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|