C17H16Cl2N2O5 — CID 7261704
2-(2,4-dichlorophenoxy)ethyl 4-(dimethylamino)-3-nitrobenzoate (PubChem CID 7261704) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 4-(dimethylamino)-3-nitrobenzoate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 4-(dimethylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7261704 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 4-(dimethylamino)-3-nitrobenzoate |
| SMILES | CN(C)c1ccc(C(=O)OCCOc2ccc(Cl)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16Cl2N2O5/c1-20(2)14-5-3-11(9-15(14)21(23)24)17(22)26-8-7-25-16-6-4-12(18)10-13(16)19/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | UYDFVNZOLQNJDL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|