C6H10N2OS — CID 11228942
O-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]hydroxylamine (PubChem CID 11228942) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is O-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 11228942 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | O-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]hydroxylamine |
| SMILES | Cc1ncsc1CCON |
| InChI | InChI=1S/C6H10N2OS/c1-5-6(2-3-9-7)10-4-8-5/h4H,2-3,7H2,1H3 |
| InChIKey | BYBMPIKWWLMFGN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|