About 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide
2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide (PubChem CID 53398787) has the molecular formula C6H12Br2N2S
and a molecular weight of 304.05 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide.
Analyze 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide (CID 53398787) is 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide is Br.Br.Cc1ncsc1CCN.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide?
The InChIKey is ZKLGVMDJEVAZGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S.2BrH/c1-5-6(2-3-7)9-4-8-5;;/h4H,2-3,7H2,1H3;2*1H.
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide?
2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide has a molecular weight of 304.05 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)ethanamine;dihydrobromide is sourced from PubChem (CID 53398787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).