C16H20N2O4S2 — CID 10406736
bis[2-(4-methyl-1,3-thiazol-5-yl)ethyl] butanedioate (PubChem CID 10406736) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is bis[2-(4-methyl-1,3-thiazol-5-yl)ethyl] butanedioate.
| Compound Name | bis[2-(4-methyl-1,3-thiazol-5-yl)ethyl] butanedioate |
|---|---|
| PubChem CID | 10406736 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | bis[2-(4-methyl-1,3-thiazol-5-yl)ethyl] butanedioate |
| SMILES | Cc1ncsc1CCOC(=O)CCC(=O)OCCc1scnc1C |
| InChI | InChI=1S/C16H20N2O4S2/c1-11-13(23-9-17-11)5-7-21-15(19)3-4-16(20)22-8-6-14-12(2)18-10-24-14/h9-10H,3-8H2,1-2H3 |
| InChIKey | KHNUCKBFEXTLGU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |