C10H14BrNO3S — CID 81091489
methyl 2-bromo-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanoate (PubChem CID 81091489) has the molecular formula C10H14BrNO3S and a molecular weight of 308.20 g/mol. Its IUPAC name is methyl 2-bromo-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanoate.
| Compound Name | methyl 2-bromo-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanoate |
|---|---|
| PubChem CID | 81091489 |
| Molecular Formula | C10H14BrNO3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | methyl 2-bromo-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanoate |
| SMILES | COC(=O)C(Br)COCCc1scnc1C |
| InChI | InChI=1S/C10H14BrNO3S/c1-7-9(16-6-12-7)3-4-15-5-8(11)10(13)14-2/h6,8H,3-5H2,1-2H3 |
| InChIKey | URXCMECWTMPDFC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|