C11H18F2N2O2S — CID 115406578
1-(2,2-difluoroethylamino)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol (PubChem CID 115406578) has the molecular formula C11H18F2N2O2S and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-(2,2-difluoroethylamino)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol.
| Compound Name | 1-(2,2-difluoroethylamino)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 115406578 |
| Molecular Formula | C11H18F2N2O2S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(2,2-difluoroethylamino)-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol |
| SMILES | Cc1ncsc1CCOCC(O)CNCC(F)F |
| InChI | InChI=1S/C11H18F2N2O2S/c1-8-10(18-7-15-8)2-3-17-6-9(16)4-14-5-11(12)13/h7,9,11,14,16H,2-6H2,1H3 |
| InChIKey | GCWZKCZTAGFANM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|