C13H21F3N2O2S — CID 115518407
1-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol (PubChem CID 115518407) has the molecular formula C13H21F3N2O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol.
| Compound Name | 1-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol |
|---|---|
| PubChem CID | 115518407 |
| Molecular Formula | C13H21F3N2O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-3-(4,4,4-trifluorobutylamino)propan-2-ol |
| SMILES | Cc1ncsc1CCOCC(O)CNCCCC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O2S/c1-10-12(21-9-18-10)3-6-20-8-11(19)7-17-5-2-4-13(14,15)16/h9,11,17,19H,2-8H2,1H3 |
| InChIKey | OXXMTKSEGGPVOF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|