C14H25N3O3S — CID 61477069
N-ethyl-2-[[2-hydroxy-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propyl]amino]propanamide (PubChem CID 61477069) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-ethyl-2-[[2-hydroxy-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propyl]amino]propanamide.
| Compound Name | N-ethyl-2-[[2-hydroxy-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propyl]amino]propanamide |
|---|---|
| PubChem CID | 61477069 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-ethyl-2-[[2-hydroxy-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propyl]amino]propanamide |
| SMILES | CCNC(=O)C(C)NCC(O)COCCc1scnc1C |
| InChI | InChI=1S/C14H25N3O3S/c1-4-15-14(19)11(3)16-7-12(18)8-20-6-5-13-10(2)17-9-21-13/h9,11-12,16,18H,4-8H2,1-3H3,(H,15,19) |
| InChIKey | SMRXHYCHDGMGKB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|