C14H30N2O4 — CID 61477156
2-[[3-(2-butoxyethoxy)-2-hydroxypropyl]amino]-N-ethylpropanamide (PubChem CID 61477156) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-[[3-(2-butoxyethoxy)-2-hydroxypropyl]amino]-N-ethylpropanamide.
| Compound Name | 2-[[3-(2-butoxyethoxy)-2-hydroxypropyl]amino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 61477156 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[[3-(2-butoxyethoxy)-2-hydroxypropyl]amino]-N-ethylpropanamide |
| SMILES | CCCCOCCOCC(O)CNC(C)C(=O)NCC |
| InChI | InChI=1S/C14H30N2O4/c1-4-6-7-19-8-9-20-11-13(17)10-16-12(3)14(18)15-5-2/h12-13,16-17H,4-11H2,1-3H3,(H,15,18) |
| InChIKey | FSJMUBMLSCROSA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|