C14H26N2O3S2 — CID 106310112
1-[2-(3-hydroxypropylsulfanyl)ethylamino]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol (PubChem CID 106310112) has the molecular formula C14H26N2O3S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-[2-(3-hydroxypropylsulfanyl)ethylamino]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol.
| Compound Name | 1-[2-(3-hydroxypropylsulfanyl)ethylamino]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 106310112 |
| Molecular Formula | C14H26N2O3S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[2-(3-hydroxypropylsulfanyl)ethylamino]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propan-2-ol |
| SMILES | Cc1ncsc1CCOCC(O)CNCCSCCCO |
| InChI | InChI=1S/C14H26N2O3S2/c1-12-14(21-11-16-12)3-6-19-10-13(18)9-15-4-8-20-7-2-5-17/h11,13,15,17-18H,2-10H2,1H3 |
| InChIKey | FOEHFERBDLTWLG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|