C9H16N2O2S — CID 66168458
3-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]propane-1,2-diol (PubChem CID 66168458) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]propane-1,2-diol.
| Compound Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 66168458 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]propane-1,2-diol |
| SMILES | Cc1ncsc1CCNCC(O)CO |
| InChI | InChI=1S/C9H16N2O2S/c1-7-9(14-6-11-7)2-3-10-4-8(13)5-12/h6,8,10,12-13H,2-5H2,1H3 |
| InChIKey | BQVCEQOYLAQCOL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|