C10H13NO3S — CID 76940783
4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]but-2-enoic acid (PubChem CID 76940783) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]but-2-enoic acid.
| Compound Name | 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 76940783 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]but-2-enoic acid |
| SMILES | Cc1ncsc1CCOCC=CC(=O)O |
| InChI | InChI=1S/C10H13NO3S/c1-8-9(15-7-11-8)4-6-14-5-2-3-10(12)13/h2-3,7H,4-6H2,1H3,(H,12,13) |
| InChIKey | JBTRWTXOCZSYHF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|