C16H19NO2S — CID 62030778
4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1-phenylbutan-1-one (PubChem CID 62030778) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1-phenylbutan-1-one.
| Compound Name | 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 62030778 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1-phenylbutan-1-one |
| SMILES | Cc1ncsc1CCOCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO2S/c1-13-16(20-12-17-13)9-11-19-10-5-8-15(18)14-6-3-2-4-7-14/h2-4,6-7,12H,5,8-11H2,1H3 |
| InChIKey | DZXNYYUEVVKMEP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|