C14H17NOS2 — CID 79403461
4-methyl-5-[2-(2-phenylsulfanylethoxy)ethyl]-1,3-thiazole (PubChem CID 79403461) has the molecular formula C14H17NOS2 and a molecular weight of 279.43 g/mol. Its IUPAC name is 4-methyl-5-[2-(2-phenylsulfanylethoxy)ethyl]-1,3-thiazole.
| Compound Name | 4-methyl-5-[2-(2-phenylsulfanylethoxy)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 79403461 |
| Molecular Formula | C14H17NOS2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-methyl-5-[2-(2-phenylsulfanylethoxy)ethyl]-1,3-thiazole |
| SMILES | Cc1ncsc1CCOCCSc1ccccc1 |
| InChI | InChI=1S/C14H17NOS2/c1-12-14(18-11-15-12)7-8-16-9-10-17-13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3 |
| InChIKey | QQRYQKPPDLEEAW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|