C15H17NO4S — CID 43532271
2-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzoic acid (PubChem CID 43532271) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is 2-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzoic acid.
| Compound Name | 2-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 43532271 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-[2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethoxy]benzoic acid |
| SMILES | Cc1ncsc1CCOCCOc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H17NO4S/c1-11-14(21-10-16-11)6-7-19-8-9-20-13-5-3-2-4-12(13)15(17)18/h2-5,10H,6-9H2,1H3,(H,17,18) |
| InChIKey | KNQJKAIPFUZAMC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|