C9H12N2OS — CID 24697504
3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanenitrile (PubChem CID 24697504) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanenitrile.
| Compound Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanenitrile |
|---|---|
| PubChem CID | 24697504 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]propanenitrile |
| SMILES | Cc1ncsc1CCOCCC#N |
| InChI | InChI=1S/C9H12N2OS/c1-8-9(13-7-11-8)3-6-12-5-2-4-10/h7H,2-3,5-6H2,1H3 |
| InChIKey | DWEUDLOWNGBJKJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|