C13H12N2OS — CID 62071333
3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile (PubChem CID 62071333) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile.
| Compound Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 62071333 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile |
| SMILES | Cc1ncsc1CCOc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H12N2OS/c1-10-13(17-9-15-10)5-6-16-12-4-2-3-11(7-12)8-14/h2-4,7,9H,5-6H2,1H3 |
| InChIKey | POIHYBLKZQFTAL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |