C13H11ClN2OS — CID 62946834
2-chloro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile (PubChem CID 62946834) has the molecular formula C13H11ClN2OS and a molecular weight of 278.76 g/mol. Its IUPAC name is 2-chloro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile.
| Compound Name | 2-chloro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 62946834 |
| Molecular Formula | C13H11ClN2OS |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 2-chloro-4-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzonitrile |
| SMILES | Cc1ncsc1CCOc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClN2OS/c1-9-13(18-8-16-9)4-5-17-11-3-2-10(7-15)12(14)6-11/h2-3,6,8H,4-5H2,1H3 |
| InChIKey | YBKUYSMMGOGPLI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |