C15H17N5OS — CID 170147977
(Z)-3-amino-2-hydrazinyl-3-[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]prop-2-enenitrile (PubChem CID 170147977) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170147977 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]prop-2-enenitrile |
| SMILES | Cc1ncsc1CCOc1cccc(/C(N)=C(\C#N)NN)c1 |
| InChI | InChI=1S/C15H17N5OS/c1-10-14(22-9-19-10)5-6-21-12-4-2-3-11(7-12)15(17)13(8-16)20-18/h2-4,7,9,20H,5-6,17-18H2,1H3/b15-13- |
| InChIKey | AZCJXPLQFCWRRO-SQFISAMPSA-N |
| XLogP | 1.69 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|