C14H14N4OS — CID 170147919
(Z)-3-amino-2-hydrazinyl-3-[3-(thiophen-3-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 170147919) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-(thiophen-3-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-(thiophen-3-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170147919 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-(thiophen-3-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(NN)=C(/N)c1cccc(OCc2ccsc2)c1 |
| InChI | InChI=1S/C14H14N4OS/c15-7-13(18-17)14(16)11-2-1-3-12(6-11)19-8-10-4-5-20-9-10/h1-6,9,18H,8,16-17H2/b14-13- |
| InChIKey | NJHYPMSPPXOHKF-YPKPFQOOSA-N |
| XLogP | 1.94 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|