C20H21N5O2 — CID 170148018
(Z)-3-amino-2-hydrazinyl-3-[3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methoxy]phenyl]prop-2-enenitrile (PubChem CID 170148018) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170148018 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(NN)=C(/N)c1cccc(OCc2ccc(N3CCCC3=O)cc2)c1 |
| InChI | InChI=1S/C20H21N5O2/c21-12-18(24-23)20(22)15-3-1-4-17(11-15)27-13-14-6-8-16(9-7-14)25-10-2-5-19(25)26/h1,3-4,6-9,11,24H,2,5,10,13,22-23H2/b20-18- |
| InChIKey | AMPURUJEGGMGTF-ZZEZOPTASA-N |
| XLogP | 2.01 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|