C20H19N5OS — CID 170148040
(Z)-3-amino-2-hydrazinyl-3-[3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 170148040) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170148040 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | Cc1nc(-c2ccccc2)sc1COc1cccc(/C(N)=C(\C#N)NN)c1 |
| InChI | InChI=1S/C20H19N5OS/c1-13-18(27-20(24-13)14-6-3-2-4-7-14)12-26-16-9-5-8-15(10-16)19(22)17(11-21)25-23/h2-10,25H,12,22-23H2,1H3/b19-17- |
| InChIKey | CUSXWZXKEUPVST-ZPHPHTNESA-N |
| XLogP | 3.31 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|