C18H18N6O — CID 170148044
(Z)-3-amino-2-hydrazinyl-3-[3-[(2-methylindazol-3-yl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 170148044) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-[(2-methylindazol-3-yl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-[(2-methylindazol-3-yl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170148044 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-[(2-methylindazol-3-yl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | Cn1nc2ccccc2c1COc1cccc(/C(N)=C(\C#N)NN)c1 |
| InChI | InChI=1S/C18H18N6O/c1-24-17(14-7-2-3-8-15(14)23-24)11-25-13-6-4-5-12(9-13)18(20)16(10-19)22-21/h2-9,22H,11,20-21H2,1H3/b18-16- |
| InChIKey | WROIXOVTAFHGBU-VLGSPTGOSA-N |
| XLogP | 1.77 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|