C13H13N5OS — CID 170148066
(Z)-3-amino-2-hydrazinyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 170148066) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170148066 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-(1,3-thiazol-5-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(NN)=C(/N)c1cccc(OCc2cncs2)c1 |
| InChI | InChI=1S/C13H13N5OS/c14-5-12(18-16)13(15)9-2-1-3-10(4-9)19-7-11-6-17-8-20-11/h1-4,6,8,18H,7,15-16H2/b13-12- |
| InChIKey | LMMKHJHDTNFHAX-SEYXRHQNSA-N |
| XLogP | 1.34 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|