C12H11N3OS — CID 62760732
2-[3-(1,3-thiazol-5-ylmethylamino)phenoxy]acetonitrile (PubChem CID 62760732) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-[3-(1,3-thiazol-5-ylmethylamino)phenoxy]acetonitrile.
| Compound Name | 2-[3-(1,3-thiazol-5-ylmethylamino)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 62760732 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[3-(1,3-thiazol-5-ylmethylamino)phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(NCc2cncs2)c1 |
| InChI | InChI=1S/C12H11N3OS/c13-4-5-16-11-3-1-2-10(6-11)15-8-12-7-14-9-17-12/h1-3,6-7,9,15H,5,8H2 |
| InChIKey | JGAGJUXPMJPMTL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |