C15H14N2O3 — CID 43721156
2-[3-[(3,4-dihydroxyphenyl)methylamino]phenoxy]acetonitrile (PubChem CID 43721156) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[3-[(3,4-dihydroxyphenyl)methylamino]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(3,4-dihydroxyphenyl)methylamino]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 43721156 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[3-[(3,4-dihydroxyphenyl)methylamino]phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(NCc2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C15H14N2O3/c16-6-7-20-13-3-1-2-12(9-13)17-10-11-4-5-14(18)15(19)8-11/h1-5,8-9,17-19H,7,10H2 |
| InChIKey | NSOKNECSTMCMDF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|