C14H12N2O4 — CID 63317142
5-[[3-(cyanomethoxy)anilino]methyl]furan-2-carboxylic acid (PubChem CID 63317142) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-[[3-(cyanomethoxy)anilino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-(cyanomethoxy)anilino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63317142 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-[[3-(cyanomethoxy)anilino]methyl]furan-2-carboxylic acid |
| SMILES | N#CCOc1cccc(NCc2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C14H12N2O4/c15-6-7-19-11-3-1-2-10(8-11)16-9-12-4-5-13(20-12)14(17)18/h1-5,8,16H,7,9H2,(H,17,18) |
| InChIKey | QJMYZDSUSPBPIE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |