C11H10F2N2OS — CID 55109711
3-(difluoromethoxy)-N-(1,3-thiazol-5-ylmethyl)aniline (PubChem CID 55109711) has the molecular formula C11H10F2N2OS and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-(1,3-thiazol-5-ylmethyl)aniline.
| Compound Name | 3-(difluoromethoxy)-N-(1,3-thiazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 55109711 |
| Molecular Formula | C11H10F2N2OS |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-(difluoromethoxy)-N-(1,3-thiazol-5-ylmethyl)aniline |
| SMILES | FC(F)Oc1cccc(NCc2cncs2)c1 |
| InChI | InChI=1S/C11H10F2N2OS/c12-11(13)16-9-3-1-2-8(4-9)15-6-10-5-14-7-17-10/h1-5,7,11,15H,6H2 |
| InChIKey | NGXWLASHCSQYIG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |