C14H15F2N3O — CID 66163708
N-[(3-cyclopropylimidazol-4-yl)methyl]-3-(difluoromethoxy)aniline (PubChem CID 66163708) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[(3-cyclopropylimidazol-4-yl)methyl]-3-(difluoromethoxy)aniline.
| Compound Name | N-[(3-cyclopropylimidazol-4-yl)methyl]-3-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 66163708 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[(3-cyclopropylimidazol-4-yl)methyl]-3-(difluoromethoxy)aniline |
| SMILES | FC(F)Oc1cccc(NCc2cncn2C2CC2)c1 |
| InChI | InChI=1S/C14H15F2N3O/c15-14(16)20-13-3-1-2-10(6-13)18-8-12-7-17-9-19(12)11-4-5-11/h1-3,6-7,9,11,14,18H,4-5,8H2 |
| InChIKey | VHEKYRYUQSPSNT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |