C12H12N4O — CID 54976517
2-[3-(1H-imidazol-2-ylmethylamino)phenoxy]acetonitrile (PubChem CID 54976517) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-2-ylmethylamino)phenoxy]acetonitrile.
| Compound Name | 2-[3-(1H-imidazol-2-ylmethylamino)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 54976517 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-[3-(1H-imidazol-2-ylmethylamino)phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(NCc2ncc[nH]2)c1 |
| InChI | InChI=1S/C12H12N4O/c13-4-7-17-11-3-1-2-10(8-11)16-9-12-14-5-6-15-12/h1-3,5-6,8,16H,7,9H2,(H,14,15) |
| InChIKey | KDDQSDFCSXDRSZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |