C13H12N4O — CID 62749072
2-[3-(pyrimidin-4-ylmethylamino)phenoxy]acetonitrile (PubChem CID 62749072) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-[3-(pyrimidin-4-ylmethylamino)phenoxy]acetonitrile.
| Compound Name | 2-[3-(pyrimidin-4-ylmethylamino)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 62749072 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[3-(pyrimidin-4-ylmethylamino)phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(NCc2ccncn2)c1 |
| InChI | InChI=1S/C13H12N4O/c14-5-7-18-13-3-1-2-11(8-13)16-9-12-4-6-15-10-17-12/h1-4,6,8,10,16H,7,9H2 |
| InChIKey | KOTJKXVGFZXCFS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |