C11H7ClN2OS — CID 102724111
2-chloro-4-(1,3-thiazol-5-ylmethoxy)benzonitrile (PubChem CID 102724111) has the molecular formula C11H7ClN2OS and a molecular weight of 250.71 g/mol. Its IUPAC name is 2-chloro-4-(1,3-thiazol-5-ylmethoxy)benzonitrile.
| Compound Name | 2-chloro-4-(1,3-thiazol-5-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 102724111 |
| Molecular Formula | C11H7ClN2OS |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-chloro-4-(1,3-thiazol-5-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCc2cncs2)cc1Cl |
| InChI | InChI=1S/C11H7ClN2OS/c12-11-3-9(2-1-8(11)4-13)15-6-10-5-14-7-16-10/h1-3,5,7H,6H2 |
| InChIKey | FZMIKJJJTFWWPV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |