C10H7BrFNOS — CID 112640679
5-[(3-bromo-4-fluorophenoxy)methyl]-1,3-thiazole (PubChem CID 112640679) has the molecular formula C10H7BrFNOS and a molecular weight of 288.14 g/mol. Its IUPAC name is 5-[(3-bromo-4-fluorophenoxy)methyl]-1,3-thiazole.
| Compound Name | 5-[(3-bromo-4-fluorophenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112640679 |
| Molecular Formula | C10H7BrFNOS |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | 5-[(3-bromo-4-fluorophenoxy)methyl]-1,3-thiazole |
| SMILES | Fc1ccc(OCc2cncs2)cc1Br |
| InChI | InChI=1S/C10H7BrFNOS/c11-9-3-7(1-2-10(9)12)14-5-8-4-13-6-15-8/h1-4,6H,5H2 |
| InChIKey | YRSLGGHYJBWTKK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |