C12H13BFNOS — CID 58430075
[2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]-dimethylborane (PubChem CID 58430075) has the molecular formula C12H13BFNOS and a molecular weight of 249.12 g/mol. Its IUPAC name is [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]-dimethylborane.
| Compound Name | [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]-dimethylborane |
|---|---|
| PubChem CID | 58430075 |
| Molecular Formula | C12H13BFNOS |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | [2-fluoro-4-(1,3-thiazol-5-ylmethoxy)phenyl]-dimethylborane |
| SMILES | CB(C)c1ccc(OCc2cncs2)cc1F |
| InChI | InChI=1S/C12H13BFNOS/c1-13(2)11-4-3-9(5-12(11)14)16-7-10-6-15-8-17-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | IOQPWVFZVVTQSZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|