C11H8BrNO2S — CID 112640713
2-bromo-5-(1,3-thiazol-5-ylmethoxy)benzaldehyde (PubChem CID 112640713) has the molecular formula C11H8BrNO2S and a molecular weight of 298.16 g/mol. Its IUPAC name is 2-bromo-5-(1,3-thiazol-5-ylmethoxy)benzaldehyde.
| Compound Name | 2-bromo-5-(1,3-thiazol-5-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 112640713 |
| Molecular Formula | C11H8BrNO2S |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 2-bromo-5-(1,3-thiazol-5-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1cc(OCc2cncs2)ccc1Br |
| InChI | InChI=1S/C11H8BrNO2S/c12-11-2-1-9(3-8(11)5-14)15-6-10-4-13-7-16-10/h1-5,7H,6H2 |
| InChIKey | IOWVJCVSZCFLHQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|