C10H7BrFNO2 — CID 163255013
4-[(3-bromo-4-fluorophenoxy)methyl]-1,3-oxazole (PubChem CID 163255013) has the molecular formula C10H7BrFNO2 and a molecular weight of 272.07 g/mol. Its IUPAC name is 4-[(3-bromo-4-fluorophenoxy)methyl]-1,3-oxazole.
| Compound Name | 4-[(3-bromo-4-fluorophenoxy)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 163255013 |
| Molecular Formula | C10H7BrFNO2 |
| Molecular Weight | 272.07 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 4-[(3-bromo-4-fluorophenoxy)methyl]-1,3-oxazole |
| SMILES | Fc1ccc(OCc2cocn2)cc1Br |
| InChI | InChI=1S/C10H7BrFNO2/c11-9-3-8(1-2-10(9)12)15-5-7-4-14-6-13-7/h1-4,6H,5H2 |
| InChIKey | IJZDYVRVBPEVDX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.07 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |