C11H10BrFN2S — CID 112643573
1-(3-bromo-4-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 112643573) has the molecular formula C11H10BrFN2S and a molecular weight of 301.18 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 112643573 |
| Molecular Formula | C11H10BrFN2S |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | NC(Cc1cncs1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H10BrFN2S/c12-9-3-7(1-2-10(9)13)11(14)4-8-5-15-6-16-8/h1-3,5-6,11H,4,14H2 |
| InChIKey | PGTVMYFLGRDMTG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |