C9H9BrN2OS — CID 131031441
1-(5-bromofuran-3-yl)-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 131031441) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is 1-(5-bromofuran-3-yl)-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(5-bromofuran-3-yl)-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 131031441 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 1-(5-bromofuran-3-yl)-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | NC(Cc1cncs1)c1coc(Br)c1 |
| InChI | InChI=1S/C9H9BrN2OS/c10-9-1-6(4-13-9)8(11)2-7-3-12-5-14-7/h1,3-5,8H,2,11H2 |
| InChIKey | SWPVJDRPPADRPW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |