C6H11ClN2OS — CID 22747843
2-amino-3-(1,3-thiazol-5-yl)propan-1-ol;hydrochloride (PubChem CID 22747843) has the molecular formula C6H11ClN2OS and a molecular weight of 194.69 g/mol. Its IUPAC name is 2-amino-3-(1,3-thiazol-5-yl)propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-(1,3-thiazol-5-yl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 22747843 |
| Molecular Formula | C6H11ClN2OS |
| Molecular Weight | 194.69 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-amino-3-(1,3-thiazol-5-yl)propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1cncs1 |
| InChI | InChI=1S/C6H10N2OS.ClH/c7-5(3-9)1-6-2-8-4-10-6;/h2,4-5,9H,1,3,7H2;1H |
| InChIKey | YDKZARPNSFPAFX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.69 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |