C8H14N2OS — CID 58603986
(2S,4R)-2-amino-4-(1,3-thiazol-5-yl)pentan-1-ol (PubChem CID 58603986) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-(1,3-thiazol-5-yl)pentan-1-ol.
| Compound Name | (2S,4R)-2-amino-4-(1,3-thiazol-5-yl)pentan-1-ol |
|---|---|
| PubChem CID | 58603986 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (2S,4R)-2-amino-4-(1,3-thiazol-5-yl)pentan-1-ol |
| SMILES | C[C@H](C[C@H](N)CO)c1cncs1 |
| InChI | InChI=1S/C8H14N2OS/c1-6(2-7(9)4-11)8-3-10-5-12-8/h3,5-7,11H,2,4,9H2,1H3/t6-,7+/m1/s1 |
| InChIKey | FETJHUOMEUITRM-RQJHMYQMSA-N |
| XLogP | 0.96 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |