C8H13NS — CID 137491258
5-(3-methylbutan-2-yl)-1,3-thiazole (PubChem CID 137491258) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 5-(3-methylbutan-2-yl)-1,3-thiazole.
| Compound Name | 5-(3-methylbutan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 137491258 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 5-(3-methylbutan-2-yl)-1,3-thiazole |
| SMILES | CC(C)C(C)c1cncs1 |
| InChI | InChI=1S/C8H13NS/c1-6(2)7(3)8-4-9-5-10-8/h4-7H,1-3H3 |
| InChIKey | PYLUASGZWRHHQW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |