C10H16N2S — CID 115707513
1-cyclopropyl-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine (PubChem CID 115707513) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 1-cyclopropyl-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine.
| Compound Name | 1-cyclopropyl-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 115707513 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclopropyl-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine |
| SMILES | CC(NC(C)C1CC1)c1cncs1 |
| InChI | InChI=1S/C10H16N2S/c1-7(9-3-4-9)12-8(2)10-5-11-6-13-10/h5-9,12H,3-4H2,1-2H3 |
| InChIKey | KPHZYZAJIPWYIY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |