C11H14N2OS — CID 104865982
(1R)-1-(furan-2-yl)-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine (PubChem CID 104865982) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is (1R)-1-(furan-2-yl)-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine.
| Compound Name | (1R)-1-(furan-2-yl)-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 104865982 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (1R)-1-(furan-2-yl)-N-[1-(1,3-thiazol-5-yl)ethyl]ethanamine |
| SMILES | CC(N[C@H](C)c1ccco1)c1cncs1 |
| InChI | InChI=1S/C11H14N2OS/c1-8(10-4-3-5-14-10)13-9(2)11-6-12-7-15-11/h3-9,13H,1-2H3/t8-,9?/m1/s1 |
| InChIKey | KKGATBDVFCQKHH-VEDVMXKPSA-N |
| XLogP | 3.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |